C15H13FN4O4 — CID 14501373
ethyl (2S)-6-azido-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate (PubChem CID 14501373) has the molecular formula C15H13FN4O4 and a molecular weight of 332.29 g/mol. Its IUPAC name is ethyl (2S)-6-azido-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate.
| Compound Name | ethyl (2S)-6-azido-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 14501373 |
| Molecular Formula | C15H13FN4O4 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | ethyl (2S)-6-azido-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c(c(N=[N+]=[N-])c(F)cc3c1=O)OC[C@@H]2C |
| InChI | InChI=1S/C15H13FN4O4/c1-3-23-15(22)9-5-20-7(2)6-24-14-11(18-19-17)10(16)4-8(12(14)20)13(9)21/h4-5,7H,3,6H2,1-2H3/t7-/m0/s1 |
| InChIKey | VGFAUIZSMQOSFE-ZETCQYMHSA-N |
| XLogP | 3.21 |
| TPSA | 106.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|