C12H18N2O — CID 145013912
(1E)-1-[(1E,3E)-4-aminohexa-1,3,5-trienoxy]hexa-1,5-dien-3-amine (PubChem CID 145013912) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (1E)-1-[(1E,3E)-4-aminohexa-1,3,5-trienoxy]hexa-1,5-dien-3-amine.
| Compound Name | (1E)-1-[(1E,3E)-4-aminohexa-1,3,5-trienoxy]hexa-1,5-dien-3-amine |
|---|---|
| PubChem CID | 145013912 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1E)-1-[(1E,3E)-4-aminohexa-1,3,5-trienoxy]hexa-1,5-dien-3-amine |
| SMILES | C=CCC(N)/C=C/O/C=C/C=C(/N)C=C |
| InChI | InChI=1S/C12H18N2O/c1-3-6-12(14)8-10-15-9-5-7-11(13)4-2/h3-5,7-10,12H,1-2,6,13-14H2/b9-5+,10-8+,11-7+ |
| InChIKey | JPPMWDZFBHNUFI-TUVYUIGMSA-N |
| XLogP | 1.96 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|