About (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane
(Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane (PubChem CID 145014057) has the molecular formula C27H39N
and a molecular weight of 377.62 g/mol. Its IUPAC name is (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane.
Molecular Properties
| Compound Name | (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane |
| PubChem CID | 145014057 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane |
| SMILES | C/C=C\C=N\c1c(C)ccc(-c2cccc(CC(C)C)c2CCC)c1C.CC |
| InChI | InChI=1S/C25H33N.C2H6/c1-7-9-16-26-25-19(5)14-15-22(20(25)6)24-13-10-12-21(17-18(3)4)23(24)11-8-2;1-2/h7,9-10,12-16,18H,8,11,17H2,1-6H3;1-2H3/b9-7-,26-16+; |
| InChIKey | QSQXQBJZEYPWEA-NPLLFVHYSA-N |
| XLogP | 8.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane?
The IUPAC name of (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane (CID 145014057) is (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane.
What is the SMILES notation for (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane?
The canonical SMILES for (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane is C/C=C\C=N\c1c(C)ccc(-c2cccc(CC(C)C)c2CCC)c1C.CC.
What is the InChIKey of (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane?
The InChIKey is QSQXQBJZEYPWEA-NPLLFVHYSA-N. The full InChI is InChI=1S/C25H33N.C2H6/c1-7-9-16-26-25-19(5)14-15-22(20(25)6)24-13-10-12-21(17-18(3)4)23(24)11-8-2;1-2/h7,9-10,12-16,18H,8,11,17H2,1-6H3;1-2H3/b9-7-,26-16+;.
What are the key properties of (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane?
(Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane has a molecular weight of 377.62 g/mol, XLogP of 8.43, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[2,6-dimethyl-3-[3-(2-methylpropyl)-2-propylphenyl]phenyl]but-2-en-1-imine;ethane is sourced from PubChem (CID 145014057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).