C16H21FO — CID 145014074
5-ethyl-4-fluoro-1-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene (PubChem CID 145014074) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is 5-ethyl-4-fluoro-1-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene.
| Compound Name | 5-ethyl-4-fluoro-1-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145014074 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 5-ethyl-4-fluoro-1-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene |
| SMILES | C=C/C(C1=CC=C(F)C(CC)C1)=C(\C=C/C)OC |
| InChI | InChI=1S/C16H21FO/c1-5-8-16(18-4)14(7-3)13-9-10-15(17)12(6-2)11-13/h5,7-10,12H,3,6,11H2,1-2,4H3/b8-5-,16-14- |
| InChIKey | PPAIDDOJPKCSTG-KPARVCKKSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|