C23H43N4O11P — CID 145014525
[[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]-3-hydroxyoxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;methanamine (PubChem CID 145014525) has the molecular formula C23H43N4O11P and a molecular weight of 582.59 g/mol. Its IUPAC name is [[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]-3-hydroxyoxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;methanamine.
| Compound Name | [[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]-3-hydroxyoxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;methanamine |
|---|---|
| PubChem CID | 145014525 |
| Molecular Formula | C23H43N4O11P |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | [[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]-3-hydroxyoxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;methanamine |
| SMILES | CN.CN(/C=C\C(N)=N\C=O)C1CC(O)C(COP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H38N3O11P.CH5N/c1-21(2,3)19(28)31-13-34-37(30,35-14-32-20(29)22(4,5)6)33-11-16-15(27)10-18(36-16)25(7)9-8-17(23)24-12-26;1-2/h8-9,12,15-16,18,27H,10-11,13-14H2,1-7H3,(H2,23,24,26);2H2,1H3/b9-8-; |
| InChIKey | OXQRVSHMGHZBTR-UOQXYWCXSA-N |
| XLogP | 1.25 |
| TPSA | 211.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|