About CID 145014666
CID 145014666 (PubChem CID 145014666) has the molecular formula C27H39N4O
and a molecular weight of 435.64 g/mol.
Molecular Properties
| Compound Name | CID 145014666 |
| PubChem CID | 145014666 |
| Molecular Formula | C27H39N4O |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | — |
| SMILES | CC/N=C(/C=C1\CC=C(C)C(CCC[C@H](N)CC)=N1)[C@@H]1CCCCN1C(=O)C1=C[CH]C=C1 |
| InChI | InChI=1S/C27H39N4O/c1-4-22(28)13-10-14-24-20(3)16-17-23(30-24)19-25(29-5-2)26-15-8-9-18-31(26)27(32)21-11-6-7-12-21/h6-7,11-12,16,19,22,26H,4-5,8-10,13-15,17-18,28H2,1-3H3/b23-19+,29-25-/t22-,26+/m1/s1 |
| InChIKey | ILAKPJULNUMYCL-GAIZARBWSA-N |
| XLogP | 5.11 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 145014666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145014666?
The IUPAC name of CID 145014666 (CID 145014666) is not available.
What is the SMILES notation for CID 145014666?
The canonical SMILES for CID 145014666 is CC/N=C(/C=C1\CC=C(C)C(CCC[C@H](N)CC)=N1)[C@@H]1CCCCN1C(=O)C1=C[CH]C=C1.
What is the InChIKey of CID 145014666?
The InChIKey is ILAKPJULNUMYCL-GAIZARBWSA-N. The full InChI is InChI=1S/C27H39N4O/c1-4-22(28)13-10-14-24-20(3)16-17-23(30-24)19-25(29-5-2)26-15-8-9-18-31(26)27(32)21-11-6-7-12-21/h6-7,11-12,16,19,22,26H,4-5,8-10,13-15,17-18,28H2,1-3H3/b23-19+,29-25-/t22-,26+/m1/s1.
What are the key properties of CID 145014666?
CID 145014666 has a molecular weight of 435.64 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145014666 is sourced from PubChem (CID 145014666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).