C24H24FN7O — CID 145015015
1-[6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-[(4-fluorophenyl)methyl]-3-methylazetidine-3-carboxamide (PubChem CID 145015015) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-[6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-[(4-fluorophenyl)methyl]-3-methylazetidine-3-carboxamide.
| Compound Name | 1-[6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-[(4-fluorophenyl)methyl]-3-methylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 145015015 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-[6-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-[(4-fluorophenyl)methyl]-3-methylazetidine-3-carboxamide |
| SMILES | CC1(C(=O)NCc2ccc(F)cc2)CN(c2ncnn3cc(-c4cnn5c4CCC5)cc23)C1 |
| InChI | InChI=1S/C24H24FN7O/c1-24(23(33)26-10-16-4-6-18(25)7-5-16)13-30(14-24)22-21-9-17(12-32(21)29-15-27-22)19-11-28-31-8-2-3-20(19)31/h4-7,9,11-12,15H,2-3,8,10,13-14H2,1H3,(H,26,33) |
| InChIKey | DSCHPMWPYLFGKH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |