C20H24N4O — CID 145015164
3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[2,3-d][1,3]diazepin-2-one (PubChem CID 145015164) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[2,3-d][1,3]diazepin-2-one.
| Compound Name | 3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[2,3-d][1,3]diazepin-2-one |
|---|---|
| PubChem CID | 145015164 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[2,3-d][1,3]diazepin-2-one |
| SMILES | Cc1ccc(N2CCC(N3CCc4cccnc4NC3=O)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O/c1-15-4-6-17(7-5-15)23-12-9-18(10-13-23)24-14-8-16-3-2-11-21-19(16)22-20(24)25/h2-7,11,18H,8-10,12-14H2,1H3,(H,21,22,25) |
| InChIKey | QMIYXIOQWAPHPE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|