About ethane;2,4,8-trimethyl-1,5-naphthyridine
ethane;2,4,8-trimethyl-1,5-naphthyridine (PubChem CID 145015311) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is ethane;2,4,8-trimethyl-1,5-naphthyridine.
Molecular Properties
| Compound Name | ethane;2,4,8-trimethyl-1,5-naphthyridine |
| PubChem CID | 145015311 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | ethane;2,4,8-trimethyl-1,5-naphthyridine |
| SMILES | CC.Cc1cc(C)c2nccc(C)c2n1 |
| InChI | InChI=1S/C11H12N2.C2H6/c1-7-4-5-12-10-8(2)6-9(3)13-11(7)10;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | CYZUGMVMPCJTDX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2,4,8-trimethyl-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,4,8-trimethyl-1,5-naphthyridine?
The IUPAC name of ethane;2,4,8-trimethyl-1,5-naphthyridine (CID 145015311) is ethane;2,4,8-trimethyl-1,5-naphthyridine.
What is the SMILES notation for ethane;2,4,8-trimethyl-1,5-naphthyridine?
The canonical SMILES for ethane;2,4,8-trimethyl-1,5-naphthyridine is CC.Cc1cc(C)c2nccc(C)c2n1.
What is the InChIKey of ethane;2,4,8-trimethyl-1,5-naphthyridine?
The InChIKey is CYZUGMVMPCJTDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.C2H6/c1-7-4-5-12-10-8(2)6-9(3)13-11(7)10;1-2/h4-6H,1-3H3;1-2H3.
What are the key properties of ethane;2,4,8-trimethyl-1,5-naphthyridine?
ethane;2,4,8-trimethyl-1,5-naphthyridine has a molecular weight of 202.30 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,4,8-trimethyl-1,5-naphthyridine is sourced from PubChem (CID 145015311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).