About 6-ethoxy-2,4,8-trimethylquinoline
6-ethoxy-2,4,8-trimethylquinoline (PubChem CID 145015351) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-ethoxy-2,4,8-trimethylquinoline.
Molecular Properties
| Compound Name | 6-ethoxy-2,4,8-trimethylquinoline |
| PubChem CID | 145015351 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-ethoxy-2,4,8-trimethylquinoline |
| SMILES | CCOc1cc(C)c2nc(C)cc(C)c2c1 |
| InChI | InChI=1S/C14H17NO/c1-5-16-12-7-10(3)14-13(8-12)9(2)6-11(4)15-14/h6-8H,5H2,1-4H3 |
| InChIKey | NOIJEJJVQNSVIQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethoxy-2,4,8-trimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2,4,8-trimethylquinoline?
The IUPAC name of 6-ethoxy-2,4,8-trimethylquinoline (CID 145015351) is 6-ethoxy-2,4,8-trimethylquinoline.
What is the SMILES notation for 6-ethoxy-2,4,8-trimethylquinoline?
The canonical SMILES for 6-ethoxy-2,4,8-trimethylquinoline is CCOc1cc(C)c2nc(C)cc(C)c2c1.
What is the InChIKey of 6-ethoxy-2,4,8-trimethylquinoline?
The InChIKey is NOIJEJJVQNSVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-5-16-12-7-10(3)14-13(8-12)9(2)6-11(4)15-14/h6-8H,5H2,1-4H3.
What are the key properties of 6-ethoxy-2,4,8-trimethylquinoline?
6-ethoxy-2,4,8-trimethylquinoline has a molecular weight of 215.30 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,4,8-trimethylquinoline is sourced from PubChem (CID 145015351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).