C19H22FN3O2 — CID 1450155
1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]urea (PubChem CID 1450155) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]urea.
| Compound Name | 1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]urea |
|---|---|
| PubChem CID | 1450155 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-cyclohexyl-3-[1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]urea |
| SMILES | O=C(Nc1cccn(Cc2cccc(F)c2)c1=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H22FN3O2/c20-15-7-4-6-14(12-15)13-23-11-5-10-17(18(23)24)22-19(25)21-16-8-2-1-3-9-16/h4-7,10-12,16H,1-3,8-9,13H2,(H2,21,22,25) |
| InChIKey | MJQIWFWTNDKYIE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |