C13H18FN3S — CID 145015682
(6S)-4-(5-amino-2-fluoro-3-methylphenyl)-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 145015682) has the molecular formula C13H18FN3S and a molecular weight of 267.37 g/mol. Its IUPAC name is (6S)-4-(5-amino-2-fluoro-3-methylphenyl)-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | (6S)-4-(5-amino-2-fluoro-3-methylphenyl)-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 145015682 |
| Molecular Formula | C13H18FN3S |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (6S)-4-(5-amino-2-fluoro-3-methylphenyl)-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | Cc1cc(N)cc(C2N=C(N)S[C@@H](C)C2C)c1F |
| InChI | InChI=1S/C13H18FN3S/c1-6-4-9(15)5-10(11(6)14)12-7(2)8(3)18-13(16)17-12/h4-5,7-8,12H,15H2,1-3H3,(H2,16,17)/t7?,8-,12?/m0/s1 |
| InChIKey | XYHBNDDYULSLRJ-XIGTVVQJSA-N |
| XLogP | 2.84 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|