C14H18FIN6S2 — CID 145015705
[(E)-1-amino-2-[amino-[[3-amino-5-(5-amino-2-fluorophenyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]amino]ethenyl] thiohypoiodite (PubChem CID 145015705) has the molecular formula C14H18FIN6S2 and a molecular weight of 480.38 g/mol. Its IUPAC name is [(E)-1-amino-2-[amino-[[3-amino-5-(5-amino-2-fluorophenyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]amino]ethenyl] thiohypoiodite.
| Compound Name | [(E)-1-amino-2-[amino-[[3-amino-5-(5-amino-2-fluorophenyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]amino]ethenyl] thiohypoiodite |
|---|---|
| PubChem CID | 145015705 |
| Molecular Formula | C14H18FIN6S2 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | [(E)-1-amino-2-[amino-[[3-amino-5-(5-amino-2-fluorophenyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]amino]ethenyl] thiohypoiodite |
| SMILES | NC1=NC(c2cc(N)ccc2F)C2CC2(CN(N)/C=C(\N)SI)S1 |
| InChI | InChI=1S/C14H18FIN6S2/c15-10-2-1-7(17)3-8(10)12-9-4-14(9,23-13(19)21-12)6-22(20)5-11(18)24-16/h1-3,5,9,12H,4,6,17-18,20H2,(H2,19,21)/b11-5+ |
| InChIKey | SNBRUSXKBCJPEM-VZUCSPMQSA-N |
| XLogP | 2.29 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|