C18H22N2 — CID 145017010
N-[1-(5,6,9,9a-tetrahydro-1H-fluoren-4-yl)ethylidene]-N'-methylethanimidamide (PubChem CID 145017010) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-[1-(5,6,9,9a-tetrahydro-1H-fluoren-4-yl)ethylidene]-N'-methylethanimidamide.
| Compound Name | N-[1-(5,6,9,9a-tetrahydro-1H-fluoren-4-yl)ethylidene]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 145017010 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-[1-(5,6,9,9a-tetrahydro-1H-fluoren-4-yl)ethylidene]-N'-methylethanimidamide |
| SMILES | C/N=C(C)/N=C(\C)C1=C2C3=C(C=CCC3)CC2CC=C1 |
| InChI | InChI=1S/C18H22N2/c1-12(20-13(2)19-3)16-10-6-8-15-11-14-7-4-5-9-17(14)18(15)16/h4,6-7,10,15H,5,8-9,11H2,1-3H3/b19-13+,20-12+ |
| InChIKey | LHLKICVBJCGHRY-JUARGUKUSA-N |
| XLogP | 4.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|