C26H30F3N3O4 — CID 145017583
(7Z)-3-(3-hydroxypropyl)-1,8-dimethyl-6-[(4-methylphenyl)methyl]-7-[3-(trifluoromethoxy)phenyl]-5,9-dihydro-1,3,6-triazonine-2,4-dione (PubChem CID 145017583) has the molecular formula C26H30F3N3O4 and a molecular weight of 505.54 g/mol. Its IUPAC name is (7Z)-3-(3-hydroxypropyl)-1,8-dimethyl-6-[(4-methylphenyl)methyl]-7-[3-(trifluoromethoxy)phenyl]-5,9-dihydro-1,3,6-triazonine-2,4-dione.
| Compound Name | (7Z)-3-(3-hydroxypropyl)-1,8-dimethyl-6-[(4-methylphenyl)methyl]-7-[3-(trifluoromethoxy)phenyl]-5,9-dihydro-1,3,6-triazonine-2,4-dione |
|---|---|
| PubChem CID | 145017583 |
| Molecular Formula | C26H30F3N3O4 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (7Z)-3-(3-hydroxypropyl)-1,8-dimethyl-6-[(4-methylphenyl)methyl]-7-[3-(trifluoromethoxy)phenyl]-5,9-dihydro-1,3,6-triazonine-2,4-dione |
| SMILES | C/C1=C(\c2cccc(OC(F)(F)F)c2)N(Cc2ccc(C)cc2)CC(=O)N(CCCO)C(=O)N(C)C1 |
| InChI | InChI=1S/C26H30F3N3O4/c1-18-8-10-20(11-9-18)16-31-17-23(34)32(12-5-13-33)25(35)30(3)15-19(2)24(31)21-6-4-7-22(14-21)36-26(27,28)29/h4,6-11,14,33H,5,12-13,15-17H2,1-3H3/b24-19- |
| InChIKey | PWBLNEBJYRAMFX-CLCOLTQESA-N |
| XLogP | 4.40 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |