C15H26N2 — CID 145017836
(1Z,3Z)-1-[(Z)-ethylideneamino]-N-methyl-2-prop-1-en-2-ylhexa-1,3,5-trien-1-amine;propane (PubChem CID 145017836) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (1Z,3Z)-1-[(Z)-ethylideneamino]-N-methyl-2-prop-1-en-2-ylhexa-1,3,5-trien-1-amine;propane.
| Compound Name | (1Z,3Z)-1-[(Z)-ethylideneamino]-N-methyl-2-prop-1-en-2-ylhexa-1,3,5-trien-1-amine;propane |
|---|---|
| PubChem CID | 145017836 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (1Z,3Z)-1-[(Z)-ethylideneamino]-N-methyl-2-prop-1-en-2-ylhexa-1,3,5-trien-1-amine;propane |
| SMILES | C=C/C=C\C(C(=C)C)=C(\N=C/C)NC.CCC |
| InChI | InChI=1S/C12H18N2.C3H8/c1-6-8-9-11(10(3)4)12(13-5)14-7-2;1-3-2/h6-9,13H,1,3H2,2,4-5H3;3H2,1-2H3/b9-8-,12-11-,14-7-; |
| InChIKey | KZACBUFFFGZBFO-NBOUBHOZSA-N |
| XLogP | 4.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|