C24H20S3 — CID 145017988
trimethyl-[2-(16-methyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-6-yl)ethynyl]-λ4-sulfane (PubChem CID 145017988) has the molecular formula C24H20S3 and a molecular weight of 404.63 g/mol. Its IUPAC name is trimethyl-[2-(16-methyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-6-yl)ethynyl]-λ4-sulfane.
| Compound Name | trimethyl-[2-(16-methyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-6-yl)ethynyl]-λ4-sulfane |
|---|---|
| PubChem CID | 145017988 |
| Molecular Formula | C24H20S3 |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | trimethyl-[2-(16-methyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-6-yl)ethynyl]-λ4-sulfane |
| SMILES | Cc1ccc2sc3cc4c(cc3c2c1)sc1ccc(C#CS(C)(C)C)cc14 |
| InChI | InChI=1S/C24H20S3/c1-15-5-7-21-17(11-15)19-13-24-20(14-23(19)25-21)18-12-16(6-8-22(18)26-24)9-10-27(2,3)4/h5-8,11-14H,1-4H3 |
| InChIKey | QRQABLVKDRPEGN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|