C56H45N3O — CID 145018307
N'-[(Z)-3-[4-(7-tert-butyl-6-dibenzofuran-2-yl-9-phenylcarbazol-3-yl)phenyl]-1-phenylprop-1-enyl]benzenecarboximidamide (PubChem CID 145018307) has the molecular formula C56H45N3O and a molecular weight of 776.00 g/mol. Its IUPAC name is N'-[(Z)-3-[4-(7-tert-butyl-6-dibenzofuran-2-yl-9-phenylcarbazol-3-yl)phenyl]-1-phenylprop-1-enyl]benzenecarboximidamide.
| Compound Name | N'-[(Z)-3-[4-(7-tert-butyl-6-dibenzofuran-2-yl-9-phenylcarbazol-3-yl)phenyl]-1-phenylprop-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145018307 |
| Molecular Formula | C56H45N3O |
| Molecular Weight | 776.00 g/mol |
| Exact Mass | 775.36 |
| IUPAC Name | N'-[(Z)-3-[4-(7-tert-butyl-6-dibenzofuran-2-yl-9-phenylcarbazol-3-yl)phenyl]-1-phenylprop-1-enyl]benzenecarboximidamide |
| SMILES | CC(C)(C)c1cc2c(cc1-c1ccc3oc4ccccc4c3c1)c1cc(-c3ccc(C/C=C(\N=C(/N)c4ccccc4)c4ccccc4)cc3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C56H45N3O/c1-56(2,3)49-36-52-47(35-45(49)42-29-32-54-48(34-42)44-21-13-14-22-53(44)60-54)46-33-41(28-31-51(46)59(52)43-19-11-6-12-20-43)38-26-23-37(24-27-38)25-30-50(39-15-7-4-8-16-39)58-55(57)40-17-9-5-10-18-40/h4-24,26-36H,25H2,1-3H3,(H2,57,58)/b50-30- |
| InChIKey | MASSIBFIBDMCCE-DBQHZJLUSA-N |
| XLogP | 14.30 |
| TPSA | 56.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.00 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|