About 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one
2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one (PubChem CID 14501849) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one |
| PubChem CID | 14501849 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cnn2cccnc12 |
| InChI | InChI=1S/C11H13N3O/c1-11(2,3)9(15)8-7-13-14-6-4-5-12-10(8)14/h4-7H,1-3H3 |
| InChIKey | LUOHPJIIRCEWJW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one?
The IUPAC name of 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one (CID 14501849) is 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one.
What is the SMILES notation for 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one?
The canonical SMILES for 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one is CC(C)(C)C(=O)c1cnn2cccnc12.
What is the InChIKey of 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one?
The InChIKey is LUOHPJIIRCEWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-11(2,3)9(15)8-7-13-14-6-4-5-12-10(8)14/h4-7H,1-3H3.
What are the key properties of 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one?
2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one has a molecular weight of 203.25 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-pyrazolo[1,5-a]pyrimidin-3-ylpropan-1-one is sourced from PubChem (CID 14501849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).