About 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile
2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 14501859) has the molecular formula C8H6N4
and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| PubChem CID | 14501859 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| SMILES | Cc1nn2cccnc2c1C#N |
| InChI | InChI=1S/C8H6N4/c1-6-7(5-9)8-10-3-2-4-12(8)11-6/h2-4H,1H3 |
| InChIKey | WZPVLOVVCCUEDS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The IUPAC name of 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile (CID 14501859) is 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile.
What is the SMILES notation for 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The canonical SMILES for 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile is Cc1nn2cccnc2c1C#N.
What is the InChIKey of 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
The InChIKey is WZPVLOVVCCUEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4/c1-6-7(5-9)8-10-3-2-4-12(8)11-6/h2-4H,1H3.
What are the key properties of 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile?
2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile has a molecular weight of 158.16 g/mol, XLogP of 0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile is sourced from PubChem (CID 14501859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).