About 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole
6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole (PubChem CID 145018647) has the molecular formula C6H5FN2S
and a molecular weight of 156.19 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole.
Molecular Properties
| Compound Name | 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole |
| PubChem CID | 145018647 |
| Molecular Formula | C6H5FN2S |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole |
| SMILES | Fc1ccc2c(c1)SNN2 |
| InChI | InChI=1S/C6H5FN2S/c7-4-1-2-5-6(3-4)10-9-8-5/h1-3,8-9H |
| InChIKey | LVLMDJWHOOSPQP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole?
The IUPAC name of 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole (CID 145018647) is 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole.
What is the SMILES notation for 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole?
The canonical SMILES for 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole is Fc1ccc2c(c1)SNN2.
What is the InChIKey of 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole?
The InChIKey is LVLMDJWHOOSPQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2S/c7-4-1-2-5-6(3-4)10-9-8-5/h1-3,8-9H.
What are the key properties of 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole?
6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole has a molecular weight of 156.19 g/mol, XLogP of 1.76, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,3-dihydro-1,2,3-benzothiadiazole is sourced from PubChem (CID 145018647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).