About ethane;2-ethylguanidine
ethane;2-ethylguanidine (PubChem CID 145018859) has the molecular formula C5H15N3
and a molecular weight of 117.20 g/mol. Its IUPAC name is ethane;2-ethylguanidine.
Molecular Properties
| Compound Name | ethane;2-ethylguanidine |
| PubChem CID | 145018859 |
| Molecular Formula | C5H15N3 |
| Molecular Weight | 117.20 g/mol |
| Exact Mass | 117.13 |
| IUPAC Name | ethane;2-ethylguanidine |
| SMILES | CC.CCN=C(N)N |
| InChI | InChI=1S/C3H9N3.C2H6/c1-2-6-3(4)5;1-2/h2H2,1H3,(H4,4,5,6);1-2H3 |
| InChIKey | YMJXZGNWNZTFGO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylguanidine?
The IUPAC name of ethane;2-ethylguanidine (CID 145018859) is ethane;2-ethylguanidine.
What is the SMILES notation for ethane;2-ethylguanidine?
The canonical SMILES for ethane;2-ethylguanidine is CC.CCN=C(N)N.
What is the InChIKey of ethane;2-ethylguanidine?
The InChIKey is YMJXZGNWNZTFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3.C2H6/c1-2-6-3(4)5;1-2/h2H2,1H3,(H4,4,5,6);1-2H3.
What are the key properties of ethane;2-ethylguanidine?
ethane;2-ethylguanidine has a molecular weight of 117.20 g/mol, XLogP of 0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylguanidine is sourced from PubChem (CID 145018859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).