C17H39NO3 — CID 145018893
2-(2-but-3-enoxyethoxy)-N-methylethanamine;2-methoxy-2-methylpropane;propane (PubChem CID 145018893) has the molecular formula C17H39NO3 and a molecular weight of 305.50 g/mol. Its IUPAC name is 2-(2-but-3-enoxyethoxy)-N-methylethanamine;2-methoxy-2-methylpropane;propane.
| Compound Name | 2-(2-but-3-enoxyethoxy)-N-methylethanamine;2-methoxy-2-methylpropane;propane |
|---|---|
| PubChem CID | 145018893 |
| Molecular Formula | C17H39NO3 |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 305.29 |
| IUPAC Name | 2-(2-but-3-enoxyethoxy)-N-methylethanamine;2-methoxy-2-methylpropane;propane |
| SMILES | C=CCCOCCOCCNC.CCC.COC(C)(C)C |
| InChI | InChI=1S/C9H19NO2.C5H12O.C3H8/c1-3-4-6-11-8-9-12-7-5-10-2;1-5(2,3)6-4;1-3-2/h3,10H,1,4-9H2,2H3;1-4H3;3H2,1-2H3 |
| InChIKey | AGSGABJZCPEJRU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|