C12H16O5S2 — CID 14501926
methyl 6-(methylsulfonyloxymethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 14501926) has the molecular formula C12H16O5S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 6-(methylsulfonyloxymethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 6-(methylsulfonyloxymethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 14501926 |
| Molecular Formula | C12H16O5S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | methyl 6-(methylsulfonyloxymethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)CC(COS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C12H16O5S2/c1-16-12(13)11-6-9-4-3-8(5-10(9)18-11)7-17-19(2,14)15/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | RLTHUXIWDNHOSV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|