C33H40N4 — CID 145019517
2,4,4-trimethyl-7-[7-[(2E,4E)-5-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)penta-2,4-dien-2-yl]spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-quinazoline (PubChem CID 145019517) has the molecular formula C33H40N4 and a molecular weight of 492.71 g/mol. Its IUPAC name is 2,4,4-trimethyl-7-[7-[(2E,4E)-5-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)penta-2,4-dien-2-yl]spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-quinazoline.
| Compound Name | 2,4,4-trimethyl-7-[7-[(2E,4E)-5-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)penta-2,4-dien-2-yl]spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-quinazoline |
|---|---|
| PubChem CID | 145019517 |
| Molecular Formula | C33H40N4 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 2,4,4-trimethyl-7-[7-[(2E,4E)-5-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)penta-2,4-dien-2-yl]spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-quinazoline |
| SMILES | CC1=NC(C)(C)c2ccc(-c3ccc(/C(C)=C/C=C/C4CN=C(C)N4)c4c3CC3(CCCC3)C4)cc2N1 |
| InChI | InChI=1S/C33H40N4/c1-21(9-8-10-25-20-34-22(2)35-25)26-12-13-27(29-19-33(18-28(26)29)15-6-7-16-33)24-11-14-30-31(17-24)36-23(3)37-32(30,4)5/h8-14,17,25H,6-7,15-16,18-20H2,1-5H3,(H,34,35)(H,36,37)/b10-8+,21-9+ |
| InChIKey | UKLKQFZEFXMIKI-UUYQRNOUSA-N |
| XLogP | 7.44 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|