C13H18O5S2 — CID 14501961
methyl 5-(2-methylsulfonyloxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 14501961) has the molecular formula C13H18O5S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is methyl 5-(2-methylsulfonyloxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-(2-methylsulfonyloxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 14501961 |
| Molecular Formula | C13H18O5S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | methyl 5-(2-methylsulfonyloxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)CCC(CCOS(C)(=O)=O)C2 |
| InChI | InChI=1S/C13H18O5S2/c1-17-13(14)12-8-10-7-9(3-4-11(10)19-12)5-6-18-20(2,15)16/h8-9H,3-7H2,1-2H3 |
| InChIKey | SQFTZXXTRAYKND-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|