About 2-butyl-3,3-dimethyl-6,7-dihydroindole
2-butyl-3,3-dimethyl-6,7-dihydroindole (PubChem CID 145020249) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-butyl-3,3-dimethyl-6,7-dihydroindole.
Molecular Properties
| Compound Name | 2-butyl-3,3-dimethyl-6,7-dihydroindole |
| PubChem CID | 145020249 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-butyl-3,3-dimethyl-6,7-dihydroindole |
| SMILES | CCCCC1=NC2=C(C=CCC2)C1(C)C |
| InChI | InChI=1S/C14H21N/c1-4-5-10-13-14(2,3)11-8-6-7-9-12(11)15-13/h6,8H,4-5,7,9-10H2,1-3H3 |
| InChIKey | VHXOOKZSXBNTCS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butyl-3,3-dimethyl-6,7-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3,3-dimethyl-6,7-dihydroindole?
The IUPAC name of 2-butyl-3,3-dimethyl-6,7-dihydroindole (CID 145020249) is 2-butyl-3,3-dimethyl-6,7-dihydroindole.
What is the SMILES notation for 2-butyl-3,3-dimethyl-6,7-dihydroindole?
The canonical SMILES for 2-butyl-3,3-dimethyl-6,7-dihydroindole is CCCCC1=NC2=C(C=CCC2)C1(C)C.
What is the InChIKey of 2-butyl-3,3-dimethyl-6,7-dihydroindole?
The InChIKey is VHXOOKZSXBNTCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-4-5-10-13-14(2,3)11-8-6-7-9-12(11)15-13/h6,8H,4-5,7,9-10H2,1-3H3.
What are the key properties of 2-butyl-3,3-dimethyl-6,7-dihydroindole?
2-butyl-3,3-dimethyl-6,7-dihydroindole has a molecular weight of 203.33 g/mol, XLogP of 4.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3,3-dimethyl-6,7-dihydroindole is sourced from PubChem (CID 145020249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).