C22H29N2+ — CID 145020263
(3Z)-5-[2-(5-ethenyl-1,3,3,4-tetramethylpyrrol-2-ylidene)ethylidene]-1-methyl-2H-azecin-1-ium (PubChem CID 145020263) has the molecular formula C22H29N2+ and a molecular weight of 321.49 g/mol. Its IUPAC name is (3Z)-5-[2-(5-ethenyl-1,3,3,4-tetramethylpyrrol-2-ylidene)ethylidene]-1-methyl-2H-azecin-1-ium.
| Compound Name | (3Z)-5-[2-(5-ethenyl-1,3,3,4-tetramethylpyrrol-2-ylidene)ethylidene]-1-methyl-2H-azecin-1-ium |
|---|---|
| PubChem CID | 145020263 |
| Molecular Formula | C22H29N2+ |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (3Z)-5-[2-(5-ethenyl-1,3,3,4-tetramethylpyrrol-2-ylidene)ethylidene]-1-methyl-2H-azecin-1-ium |
| SMILES | C=CC1=C(C)C(C)(C)C(=CC=C2C=CC=C/C=[N+](\C)C/C=C\2)N1C |
| InChI | InChI=1S/C22H29N2/c1-7-20-18(2)22(3,4)21(24(20)6)15-14-19-12-9-8-10-16-23(5)17-11-13-19/h7-16H,1,17H2,2-6H3/q+1/b13-11- |
| InChIKey | SSLYXWRPCRUNNY-QBFSEMIESA-N |
| XLogP | 4.62 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|