C15H18F3NO — CID 14502065
N-ethyl-N-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]formamide (PubChem CID 14502065) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is N-ethyl-N-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]formamide.
| Compound Name | N-ethyl-N-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]formamide |
|---|---|
| PubChem CID | 14502065 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-ethyl-N-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]formamide |
| SMILES | CCN(C=O)C1CCc2ccc(C(F)(F)F)cc2CC1 |
| InChI | InChI=1S/C15H18F3NO/c1-2-19(10-20)14-7-4-11-3-6-13(15(16,17)18)9-12(11)5-8-14/h3,6,9-10,14H,2,4-5,7-8H2,1H3 |
| InChIKey | DJOFUAIEZJMIIV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|