C16H20N2O5 — CID 145021014
acetylene;11,13-dihydroxy-5-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione;ethene (PubChem CID 145021014) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is acetylene;11,13-dihydroxy-5-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione;ethene.
| Compound Name | acetylene;11,13-dihydroxy-5-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione;ethene |
|---|---|
| PubChem CID | 145021014 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | acetylene;11,13-dihydroxy-5-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione;ethene |
| SMILES | C#C.C=C.CC1CCN2C(=O)c3c(O)c(=O)c(O)cn3CC2O1 |
| InChI | InChI=1S/C12H14N2O5.C2H4.C2H2/c1-6-2-3-14-8(19-6)5-13-4-7(15)10(16)11(17)9(13)12(14)18;2*1-2/h4,6,8,15,17H,2-3,5H2,1H3;1-2H2;1-2H |
| InChIKey | IQOIXUSEMDAICB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|