C23H33IN4O3S — CID 145021360
N-tert-butylacetamide;[[2-[[4-(naphthalen-1-ylmethylamino)-4-oxobutan-2-yl]amino]-2-oxoethyl]amino] thiohypoiodite (PubChem CID 145021360) has the molecular formula C23H33IN4O3S and a molecular weight of 572.51 g/mol. Its IUPAC name is N-tert-butylacetamide;[[2-[[4-(naphthalen-1-ylmethylamino)-4-oxobutan-2-yl]amino]-2-oxoethyl]amino] thiohypoiodite.
| Compound Name | N-tert-butylacetamide;[[2-[[4-(naphthalen-1-ylmethylamino)-4-oxobutan-2-yl]amino]-2-oxoethyl]amino] thiohypoiodite |
|---|---|
| PubChem CID | 145021360 |
| Molecular Formula | C23H33IN4O3S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | N-tert-butylacetamide;[[2-[[4-(naphthalen-1-ylmethylamino)-4-oxobutan-2-yl]amino]-2-oxoethyl]amino] thiohypoiodite |
| SMILES | CC(=O)NC(C)(C)C.CC(CC(=O)NCc1cccc2ccccc12)NC(=O)CNSI |
| InChI | InChI=1S/C17H20IN3O2S.C6H13NO/c1-12(21-17(23)11-20-24-18)9-16(22)19-10-14-7-4-6-13-5-2-3-8-15(13)14;1-5(8)7-6(2,3)4/h2-8,12,20H,9-11H2,1H3,(H,19,22)(H,21,23);1-4H3,(H,7,8) |
| InChIKey | IBXDXVPSWGDLFU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|