About N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine
N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine (PubChem CID 145021388) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine.
Molecular Properties
| Compound Name | N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine |
| PubChem CID | 145021388 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine |
| SMILES | CCCN.O=CNc1cccc2c1C=CCC2 |
| InChI | InChI=1S/C11H11NO.C3H9N/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-2-3-4/h2-3,5-8H,1,4H2,(H,12,13);2-4H2,1H3 |
| InChIKey | XQGCTKNITGANHX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine?
The IUPAC name of N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine (CID 145021388) is N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine.
What is the SMILES notation for N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine?
The canonical SMILES for N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine is CCCN.O=CNc1cccc2c1C=CCC2.
What is the InChIKey of N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine?
The InChIKey is XQGCTKNITGANHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO.C3H9N/c13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-2-3-4/h2-3,5-8H,1,4H2,(H,12,13);2-4H2,1H3.
What are the key properties of N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine?
N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine has a molecular weight of 232.33 g/mol, XLogP of 2.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dihydronaphthalen-1-yl)formamide;propan-1-amine is sourced from PubChem (CID 145021388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).