About 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane
1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane (PubChem CID 145022205) has the molecular formula C17H29NO
and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane.
Molecular Properties
| Compound Name | 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane |
| PubChem CID | 145022205 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane |
| SMILES | CC.CCC(=O)CCN(C)CCC1=CC=CCC=C1 |
| InChI | InChI=1S/C15H23NO.C2H6/c1-3-15(17)11-13-16(2)12-10-14-8-6-4-5-7-9-14;1-2/h4,6-9H,3,5,10-13H2,1-2H3;1-2H3 |
| InChIKey | ZLVRMTUHQQEPGI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane?
The IUPAC name of 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane (CID 145022205) is 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane.
What is the SMILES notation for 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane?
The canonical SMILES for 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane is CC.CCC(=O)CCN(C)CCC1=CC=CCC=C1.
What is the InChIKey of 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane?
The InChIKey is ZLVRMTUHQQEPGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO.C2H6/c1-3-15(17)11-13-16(2)12-10-14-8-6-4-5-7-9-14;1-2/h4,6-9H,3,5,10-13H2,1-2H3;1-2H3.
What are the key properties of 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane?
1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane has a molecular weight of 263.43 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-cyclohepta-1,3,6-trien-1-ylethyl(methyl)amino]pentan-3-one;ethane is sourced from PubChem (CID 145022205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).