About 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane
2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane (PubChem CID 145022337) has the molecular formula C24H25ClN2O
and a molecular weight of 392.93 g/mol. Its IUPAC name is 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane.
Molecular Properties
| Compound Name | 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane |
| PubChem CID | 145022337 |
| Molecular Formula | C24H25ClN2O |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane |
| SMILES | CC.Cn1c(-c2ccccn2)c(C(CO)c2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H19ClN2O.C2H6/c1-25-20-13-16(23)10-11-17(20)21(22(25)19-9-5-6-12-24-19)18(14-26)15-7-3-2-4-8-15;1-2/h2-13,18,26H,14H2,1H3;1-2H3 |
| InChIKey | ONFWWTBYPOJBPZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane?
The IUPAC name of 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane (CID 145022337) is 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane.
What is the SMILES notation for 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane?
The canonical SMILES for 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane is CC.Cn1c(-c2ccccn2)c(C(CO)c2ccccc2)c2ccc(Cl)cc21.
What is the InChIKey of 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane?
The InChIKey is ONFWWTBYPOJBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN2O.C2H6/c1-25-20-13-16(23)10-11-17(20)21(22(25)19-9-5-6-12-24-19)18(14-26)15-7-3-2-4-8-15;1-2/h2-13,18,26H,14H2,1H3;1-2H3.
What are the key properties of 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane?
2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane has a molecular weight of 392.93 g/mol, XLogP of 6.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-1-methyl-2-pyridin-2-ylindol-3-yl)-2-phenylethanol;ethane is sourced from PubChem (CID 145022337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).