C33H44Cl2N4O8 — CID 145022506
7-O-tert-butyl 2-O-ethyl 4-chloro-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate;7-O-tert-butyl 2-O-ethyl (6R)-4-chloro-6-methyl-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate (PubChem CID 145022506) has the molecular formula C33H44Cl2N4O8 and a molecular weight of 695.64 g/mol. Its IUPAC name is 7-O-tert-butyl 2-O-ethyl 4-chloro-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate;7-O-tert-butyl 2-O-ethyl (6R)-4-chloro-6-methyl-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 2-O-ethyl 4-chloro-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate;7-O-tert-butyl 2-O-ethyl (6R)-4-chloro-6-methyl-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate |
|---|---|
| PubChem CID | 145022506 |
| Molecular Formula | C33H44Cl2N4O8 |
| Molecular Weight | 695.64 g/mol |
| Exact Mass | 694.25 |
| IUPAC Name | 7-O-tert-butyl 2-O-ethyl 4-chloro-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate;7-O-tert-butyl 2-O-ethyl (6R)-4-chloro-6-methyl-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate |
| SMILES | CCOC(=O)c1cc(Cl)c2c(n1)CN(C(=O)OC(C)(C)C)CC2.CCOC(=O)c1cc(Cl)c2c(n1)CN(C(=O)OC(C)(C)C)[C@H](C)C2 |
| InChI | InChI=1S/C17H23ClN2O4.C16H21ClN2O4/c1-6-23-15(21)13-8-12(18)11-7-10(2)20(9-14(11)19-13)16(22)24-17(3,4)5;1-5-22-14(20)12-8-11(17)10-6-7-19(9-13(10)18-12)15(21)23-16(2,3)4/h8,10H,6-7,9H2,1-5H3;8H,5-7,9H2,1-4H3/t10-;/m1./s1 |
| InChIKey | PXBFLLMTSLTTHX-HNCPQSOCSA-N |
| XLogP | 6.80 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|