About ethane;5-ethyl-3-methyl-1,2-thiazole;propane
ethane;5-ethyl-3-methyl-1,2-thiazole;propane (PubChem CID 145022524) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is ethane;5-ethyl-3-methyl-1,2-thiazole;propane.
Molecular Properties
| Compound Name | ethane;5-ethyl-3-methyl-1,2-thiazole;propane |
| PubChem CID | 145022524 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | ethane;5-ethyl-3-methyl-1,2-thiazole;propane |
| SMILES | CC.CCC.CCc1cc(C)ns1 |
| InChI | InChI=1S/C6H9NS.C3H8.C2H6/c1-3-6-4-5(2)7-8-6;1-3-2;1-2/h4H,3H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | QSCIIUVENDFAOO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-ethyl-3-methyl-1,2-thiazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-3-methyl-1,2-thiazole;propane?
The IUPAC name of ethane;5-ethyl-3-methyl-1,2-thiazole;propane (CID 145022524) is ethane;5-ethyl-3-methyl-1,2-thiazole;propane.
What is the SMILES notation for ethane;5-ethyl-3-methyl-1,2-thiazole;propane?
The canonical SMILES for ethane;5-ethyl-3-methyl-1,2-thiazole;propane is CC.CCC.CCc1cc(C)ns1.
What is the InChIKey of ethane;5-ethyl-3-methyl-1,2-thiazole;propane?
The InChIKey is QSCIIUVENDFAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS.C3H8.C2H6/c1-3-6-4-5(2)7-8-6;1-3-2;1-2/h4H,3H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;5-ethyl-3-methyl-1,2-thiazole;propane?
ethane;5-ethyl-3-methyl-1,2-thiazole;propane has a molecular weight of 201.38 g/mol, XLogP of 4.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-3-methyl-1,2-thiazole;propane is sourced from PubChem (CID 145022524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).