C14H27N5O2 — CID 145022739
(E)-2-amino-3-[[(3S,5R)-5-ethyl-3-hydroxyoxolan-2-yl]amino]-3-[(Z)-ethylideneamino]prop-2-enimidamide;prop-1-ene (PubChem CID 145022739) has the molecular formula C14H27N5O2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (E)-2-amino-3-[[(3S,5R)-5-ethyl-3-hydroxyoxolan-2-yl]amino]-3-[(Z)-ethylideneamino]prop-2-enimidamide;prop-1-ene.
| Compound Name | (E)-2-amino-3-[[(3S,5R)-5-ethyl-3-hydroxyoxolan-2-yl]amino]-3-[(Z)-ethylideneamino]prop-2-enimidamide;prop-1-ene |
|---|---|
| PubChem CID | 145022739 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | (E)-2-amino-3-[[(3S,5R)-5-ethyl-3-hydroxyoxolan-2-yl]amino]-3-[(Z)-ethylideneamino]prop-2-enimidamide;prop-1-ene |
| SMILES | C=CC.[H]/N=C(N)/C(N)=C(\N=C/C)NC1O[C@H](CC)C[C@@H]1O |
| InChI | InChI=1S/C11H21N5O2.C3H6/c1-3-6-5-7(17)11(18-6)16-10(15-4-2)8(12)9(13)14;1-3-2/h4,6-7,11,16-17H,3,5,12H2,1-2H3,(H3,13,14);3H,1H2,2H3/b10-8-,15-4-;/t6-,7+,11?;/m1./s1 |
| InChIKey | OINNTVHQWDXWHQ-WXVUKLSJSA-N |
| XLogP | 0.81 |
| TPSA | 129.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|