C30H34F3N3O5S — CID 145024035
(3R,6R,6aR)-6-[[5-[4-(4-aminophenyl)phenyl]-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane;methylsulfinylmethane (PubChem CID 145024035) has the molecular formula C30H34F3N3O5S and a molecular weight of 605.68 g/mol. Its IUPAC name is (3R,6R,6aR)-6-[[5-[4-(4-aminophenyl)phenyl]-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane;methylsulfinylmethane.
| Compound Name | (3R,6R,6aR)-6-[[5-[4-(4-aminophenyl)phenyl]-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane;methylsulfinylmethane |
|---|---|
| PubChem CID | 145024035 |
| Molecular Formula | C30H34F3N3O5S |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | (3R,6R,6aR)-6-[[5-[4-(4-aminophenyl)phenyl]-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;ethane;methylsulfinylmethane |
| SMILES | CC.CS(C)=O.Nc1ccc(-c2ccc(-c3nc4cc(O[C@@H]5COC6[C@H](O)CO[C@@H]65)[nH]c4cc3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H22F3N3O4.C2H6OS.C2H6/c27-26(28,29)17-9-18-19(10-22(31-18)36-21-12-35-24-20(33)11-34-25(21)24)32-23(17)15-3-1-13(2-4-15)14-5-7-16(30)8-6-14;1-4(2)3;1-2/h1-10,20-21,24-25,31,33H,11-12,30H2;1-2H3;1-2H3/t20-,21-,24?,25-;;/m1../s1 |
| InChIKey | SIXDDBFSRWTXGT-CXBRVDDESA-N |
| XLogP | 5.42 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|