C22H36NPS — CID 145024448
ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphanyl]-N-(2-propylsulfanylethyl)ethanamine (PubChem CID 145024448) has the molecular formula C22H36NPS and a molecular weight of 377.58 g/mol. Its IUPAC name is ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphanyl]-N-(2-propylsulfanylethyl)ethanamine.
| Compound Name | ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphanyl]-N-(2-propylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 145024448 |
| Molecular Formula | C22H36NPS |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphanyl]-N-(2-propylsulfanylethyl)ethanamine |
| SMILES | C=C/C=C(\C=C/C)P(CCNCCSCCC)c1ccccc1.CC |
| InChI | InChI=1S/C20H30NPS.C2H6/c1-4-10-19(11-5-2)22(20-12-8-7-9-13-20)16-14-21-15-18-23-17-6-3;1-2/h4-5,7-13,21H,1,6,14-18H2,2-3H3;1-2H3/b11-5-,19-10+; |
| InChIKey | PCBVRRFDYSANJP-QGWJGMEISA-N |
| XLogP | 6.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|