About methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane
methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane (PubChem CID 145024722) has the molecular formula C13H18F4N2O3
and a molecular weight of 326.29 g/mol. Its IUPAC name is methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane |
| PubChem CID | 145024722 |
| Molecular Formula | C13H18F4N2O3 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CCCc1nc(C)c(F)c(=O)n1CC(=O)OC |
| InChI | InChI=1S/C11H15FN2O3.C2H3F3/c1-4-5-8-13-7(2)10(12)11(16)14(8)6-9(15)17-3;1-2(3,4)5/h4-6H2,1-3H3;1H3 |
| InChIKey | CBZMFPYANQBAEI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane?
The IUPAC name of methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane (CID 145024722) is methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane.
What is the SMILES notation for methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane?
The canonical SMILES for methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane is CC(F)(F)F.CCCc1nc(C)c(F)c(=O)n1CC(=O)OC.
What is the InChIKey of methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane?
The InChIKey is CBZMFPYANQBAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2O3.C2H3F3/c1-4-5-8-13-7(2)10(12)11(16)14(8)6-9(15)17-3;1-2(3,4)5/h4-6H2,1-3H3;1H3.
What are the key properties of methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane?
methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane has a molecular weight of 326.29 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-fluoro-4-methyl-6-oxo-2-propylpyrimidin-1-yl)acetate;1,1,1-trifluoroethane is sourced from PubChem (CID 145024722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).