C23H26F2N5OP — CID 145025444
7-[[2-[difluoro(phosphanyl)methyl]-4-pyridinyl]methyl]-4-[(2E,4E)-1-methyliminohexa-2,4-dien-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide (PubChem CID 145025444) has the molecular formula C23H26F2N5OP and a molecular weight of 457.47 g/mol. Its IUPAC name is 7-[[2-[difluoro(phosphanyl)methyl]-4-pyridinyl]methyl]-4-[(2E,4E)-1-methyliminohexa-2,4-dien-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide.
| Compound Name | 7-[[2-[difluoro(phosphanyl)methyl]-4-pyridinyl]methyl]-4-[(2E,4E)-1-methyliminohexa-2,4-dien-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 145025444 |
| Molecular Formula | C23H26F2N5OP |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 7-[[2-[difluoro(phosphanyl)methyl]-4-pyridinyl]methyl]-4-[(2E,4E)-1-methyliminohexa-2,4-dien-3-yl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide |
| SMILES | C/C=C/C(=C\C=N\C)c1cc(C(N)=O)nc2c1CCN(Cc1ccnc(C(F)(F)P)c1)C2 |
| InChI | InChI=1S/C23H26F2N5OP/c1-3-4-16(6-8-27-2)18-12-19(22(26)31)29-20-14-30(10-7-17(18)20)13-15-5-9-28-21(11-15)23(24,25)32/h3-6,8-9,11-12H,7,10,13-14,32H2,1-2H3,(H2,26,31)/b4-3+,16-6+,27-8+ |
| InChIKey | OZKJIAUTFXBOTB-WVSOYXHHSA-N |
| XLogP | 3.72 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|