About oxane-2,5-diol
oxane-2,5-diol (PubChem CID 14502564) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is oxane-2,5-diol.
Molecular Properties
| Compound Name | oxane-2,5-diol |
| PubChem CID | 14502564 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | oxane-2,5-diol |
| SMILES | OC1CCC(O)OC1 |
| InChI | InChI=1S/C5H10O3/c6-4-1-2-5(7)8-3-4/h4-7H,1-3H2 |
| InChIKey | SQUXWJDCRQVSDZ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2,5-diol?
The IUPAC name of oxane-2,5-diol (CID 14502564) is oxane-2,5-diol.
What is the SMILES notation for oxane-2,5-diol?
The canonical SMILES for oxane-2,5-diol is OC1CCC(O)OC1.
What is the InChIKey of oxane-2,5-diol?
The InChIKey is SQUXWJDCRQVSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c6-4-1-2-5(7)8-3-4/h4-7H,1-3H2.
What are the key properties of oxane-2,5-diol?
oxane-2,5-diol has a molecular weight of 118.13 g/mol, XLogP of -0.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2,5-diol is sourced from PubChem (CID 14502564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).