About 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one
1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one (PubChem CID 145026710) has the molecular formula C19H32N2O2
and a molecular weight of 320.48 g/mol. Its IUPAC name is 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one |
| PubChem CID | 145026710 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one |
| SMILES | CC.CC.CCc1cccn(C)c1=O.Cc1cccn(C)c1=O |
| InChI | InChI=1S/C8H11NO.C7H9NO.2C2H6/c1-3-7-5-4-6-9(2)8(7)10;1-6-4-3-5-8(2)7(6)9;2*1-2/h4-6H,3H2,1-2H3;3-5H,1-2H3;2*1-2H3 |
| InChIKey | MTPRFTAKWCDKBO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one?
The IUPAC name of 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one (CID 145026710) is 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one.
What is the SMILES notation for 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one?
The canonical SMILES for 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one is CC.CC.CCc1cccn(C)c1=O.Cc1cccn(C)c1=O.
What is the InChIKey of 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one?
The InChIKey is MTPRFTAKWCDKBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C7H9NO.2C2H6/c1-3-7-5-4-6-9(2)8(7)10;1-6-4-3-5-8(2)7(6)9;2*1-2/h4-6H,3H2,1-2H3;3-5H,1-2H3;2*1-2H3.
What are the key properties of 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one?
1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one has a molecular weight of 320.48 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyridin-2-one;ethane;3-ethyl-1-methylpyridin-2-one is sourced from PubChem (CID 145026710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).