C29H54N2O3 — CID 145027104
1-amino-3-[[3-ethyl-4-[(Z)-prop-1-enyl]cyclohex-3-en-1-yl]-(3-methylbut-3-enyl)amino]propan-2-ol;(2E,4E)-2,4-dimethoxyhexa-2,4-diene;ethane (PubChem CID 145027104) has the molecular formula C29H54N2O3 and a molecular weight of 478.76 g/mol. Its IUPAC name is 1-amino-3-[[3-ethyl-4-[(Z)-prop-1-enyl]cyclohex-3-en-1-yl]-(3-methylbut-3-enyl)amino]propan-2-ol;(2E,4E)-2,4-dimethoxyhexa-2,4-diene;ethane.
| Compound Name | 1-amino-3-[[3-ethyl-4-[(Z)-prop-1-enyl]cyclohex-3-en-1-yl]-(3-methylbut-3-enyl)amino]propan-2-ol;(2E,4E)-2,4-dimethoxyhexa-2,4-diene;ethane |
|---|---|
| PubChem CID | 145027104 |
| Molecular Formula | C29H54N2O3 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.41 |
| IUPAC Name | 1-amino-3-[[3-ethyl-4-[(Z)-prop-1-enyl]cyclohex-3-en-1-yl]-(3-methylbut-3-enyl)amino]propan-2-ol;(2E,4E)-2,4-dimethoxyhexa-2,4-diene;ethane |
| SMILES | C/C=C(\C=C(/C)OC)OC.C=C(C)CCN(CC(O)CN)C1CCC(/C=C\C)=C(CC)C1.CC |
| InChI | InChI=1S/C19H34N2O.C8H14O2.C2H6/c1-5-7-17-8-9-18(12-16(17)6-2)21(11-10-15(3)4)14-19(22)13-20;1-5-8(10-4)6-7(2)9-3;1-2/h5,7,18-19,22H,3,6,8-14,20H2,1-2,4H3;5-6H,1-4H3;1-2H3/b7-5-;7-6+,8-5+; |
| InChIKey | QMETUDHAOMISNA-HOVHZZNMSA-N |
| XLogP | 6.52 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|