C23H40N2O2 — CID 145027124
N'-[(3E,5E)-3,5-dimethoxyhepta-3,5-dienyl]-N'-[3-ethyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-2-methylpropane-1,3-diamine (PubChem CID 145027124) has the molecular formula C23H40N2O2 and a molecular weight of 376.59 g/mol. Its IUPAC name is N'-[(3E,5E)-3,5-dimethoxyhepta-3,5-dienyl]-N'-[3-ethyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-2-methylpropane-1,3-diamine.
| Compound Name | N'-[(3E,5E)-3,5-dimethoxyhepta-3,5-dienyl]-N'-[3-ethyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-2-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 145027124 |
| Molecular Formula | C23H40N2O2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | N'-[(3E,5E)-3,5-dimethoxyhepta-3,5-dienyl]-N'-[3-ethyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-2-methylpropane-1,3-diamine |
| SMILES | C/C=C\C1=C(CC)CC(N(CC/C(=C\C(=C/C)OC)OC)CC(C)CN)C1 |
| InChI | InChI=1S/C23H40N2O2/c1-7-10-20-14-21(13-19(20)8-2)25(17-18(4)16-24)12-11-23(27-6)15-22(9-3)26-5/h7,9-10,15,18,21H,8,11-14,16-17,24H2,1-6H3/b10-7-,22-9+,23-15+ |
| InChIKey | TYJMYHXRDJOOLZ-APQDMYQTSA-N |
| XLogP | 4.80 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|