C36H39FN6O5 — CID 145027509
ethane;2-[6-[5-(2-fluoro-4-methylanilino)-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]acetamide (PubChem CID 145027509) has the molecular formula C36H39FN6O5 and a molecular weight of 654.74 g/mol. Its IUPAC name is ethane;2-[6-[5-(2-fluoro-4-methylanilino)-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]acetamide.
| Compound Name | ethane;2-[6-[5-(2-fluoro-4-methylanilino)-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]acetamide |
|---|---|
| PubChem CID | 145027509 |
| Molecular Formula | C36H39FN6O5 |
| Molecular Weight | 654.74 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | ethane;2-[6-[5-(2-fluoro-4-methylanilino)-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]-2,3-dihydroindol-1-yl]acetamide |
| SMILES | CC.COc1ccc(Cn2c(=O)c3c(Nc4ccc(C)cc4F)n(C)c(=O)c(C)c3n(-c3ccc4c(c3)N(CC(N)=O)CC4)c2=O)cc1 |
| InChI | InChI=1S/C34H33FN6O5.C2H6/c1-19-5-12-26(25(35)15-19)37-31-29-30(20(2)32(43)38(31)3)41(23-9-8-22-13-14-39(18-28(36)42)27(22)16-23)34(45)40(33(29)44)17-21-6-10-24(46-4)11-7-21;1-2/h5-12,15-16,37H,13-14,17-18H2,1-4H3,(H2,36,42);1-2H3 |
| InChIKey | KMCXWQQXGKYMSI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |