C22H27N5O — CID 145029079
buta-1,3-diene;8-[[2-(dimethylamino)-2-phenylethyl]amino]-6-methylpyrido[2,3-d]pyridazin-5-one (PubChem CID 145029079) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is buta-1,3-diene;8-[[2-(dimethylamino)-2-phenylethyl]amino]-6-methylpyrido[2,3-d]pyridazin-5-one.
| Compound Name | buta-1,3-diene;8-[[2-(dimethylamino)-2-phenylethyl]amino]-6-methylpyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 145029079 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | buta-1,3-diene;8-[[2-(dimethylamino)-2-phenylethyl]amino]-6-methylpyrido[2,3-d]pyridazin-5-one |
| SMILES | C=CC=C.CN(C)C(CNc1nn(C)c(=O)c2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C18H21N5O.C4H6/c1-22(2)15(13-8-5-4-6-9-13)12-20-17-16-14(10-7-11-19-16)18(24)23(3)21-17;1-3-4-2/h4-11,15H,12H2,1-3H3,(H,20,21);3-4H,1-2H2 |
| InChIKey | DIDAZOFAURFURA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|