C19H33N3O2 — CID 145029225
[4-[(2S)-1-(dimethylamino)-2-(methylamino)propyl]phenyl]-morpholin-4-ylmethanone;ethane (PubChem CID 145029225) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is [4-[(2S)-1-(dimethylamino)-2-(methylamino)propyl]phenyl]-morpholin-4-ylmethanone;ethane.
| Compound Name | [4-[(2S)-1-(dimethylamino)-2-(methylamino)propyl]phenyl]-morpholin-4-ylmethanone;ethane |
|---|---|
| PubChem CID | 145029225 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | [4-[(2S)-1-(dimethylamino)-2-(methylamino)propyl]phenyl]-morpholin-4-ylmethanone;ethane |
| SMILES | CC.CN[C@@H](C)C(c1ccc(C(=O)N2CCOCC2)cc1)N(C)C |
| InChI | InChI=1S/C17H27N3O2.C2H6/c1-13(18-2)16(19(3)4)14-5-7-15(8-6-14)17(21)20-9-11-22-12-10-20;1-2/h5-8,13,16,18H,9-12H2,1-4H3;1-2H3/t13-,16?;/m0./s1 |
| InChIKey | DQUSFBZUMDLHON-MRTSDAHRSA-N |
| XLogP | 2.40 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |