C21H25ClF2N2O — CID 145029604
(E)-3-[2-chloro-6-(1-methylimidazol-4-yl)phenyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one;ethane (PubChem CID 145029604) has the molecular formula C21H25ClF2N2O and a molecular weight of 394.89 g/mol. Its IUPAC name is (E)-3-[2-chloro-6-(1-methylimidazol-4-yl)phenyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one;ethane.
| Compound Name | (E)-3-[2-chloro-6-(1-methylimidazol-4-yl)phenyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 145029604 |
| Molecular Formula | C21H25ClF2N2O |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (E)-3-[2-chloro-6-(1-methylimidazol-4-yl)phenyl]-1-(4,4-difluorocyclohexyl)prop-2-en-1-one;ethane |
| SMILES | CC.Cn1cnc(-c2cccc(Cl)c2/C=C/C(=O)C2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C19H19ClF2N2O.C2H6/c1-24-11-17(23-12-24)15-3-2-4-16(20)14(15)5-6-18(25)13-7-9-19(21,22)10-8-13;1-2/h2-6,11-13H,7-10H2,1H3;1-2H3/b6-5+; |
| InChIKey | BCHOGEDSEYHYLV-IPZCTEOASA-N |
| XLogP | 6.17 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|