C21H27F2NO3 — CID 145029881
[(Z)-but-2-enyl] 3-(3,5-difluorophenyl)-2-[[(E)-4-methylhept-2-enoyl]amino]propanoate (PubChem CID 145029881) has the molecular formula C21H27F2NO3 and a molecular weight of 379.45 g/mol. Its IUPAC name is [(Z)-but-2-enyl] 3-(3,5-difluorophenyl)-2-[[(E)-4-methylhept-2-enoyl]amino]propanoate.
| Compound Name | [(Z)-but-2-enyl] 3-(3,5-difluorophenyl)-2-[[(E)-4-methylhept-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 145029881 |
| Molecular Formula | C21H27F2NO3 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [(Z)-but-2-enyl] 3-(3,5-difluorophenyl)-2-[[(E)-4-methylhept-2-enoyl]amino]propanoate |
| SMILES | C/C=C\COC(=O)C(Cc1cc(F)cc(F)c1)NC(=O)/C=C/C(C)CCC |
| InChI | InChI=1S/C21H27F2NO3/c1-4-6-10-27-21(26)19(13-16-11-17(22)14-18(23)12-16)24-20(25)9-8-15(3)7-5-2/h4,6,8-9,11-12,14-15,19H,5,7,10,13H2,1-3H3,(H,24,25)/b6-4-,9-8+ |
| InChIKey | XHUJTJPUDOBAPB-LJWGDIBWSA-N |
| XLogP | 4.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|